About phenylcarbamothioic S-acid;hydrofluoride
phenylcarbamothioic S-acid;hydrofluoride (PubChem CID 175225521) has the molecular formula C7H8FNOS
and a molecular weight of 173.21 g/mol. Its IUPAC name is phenylcarbamothioic S-acid;hydrofluoride.
Molecular Properties
| Compound Name | phenylcarbamothioic S-acid;hydrofluoride |
| PubChem CID | 175225521 |
| Molecular Formula | C7H8FNOS |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.03 |
| IUPAC Name | phenylcarbamothioic S-acid;hydrofluoride |
| SMILES | F.O=C(S)Nc1ccccc1 |
| InChI | InChI=1S/C7H7NOS.FH/c9-7(10)8-6-4-2-1-3-5-6;/h1-5H,(H2,8,9,10);1H |
| InChIKey | ONIVDNCQMGZWML-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze phenylcarbamothioic S-acid;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenylcarbamothioic S-acid;hydrofluoride?
The IUPAC name of phenylcarbamothioic S-acid;hydrofluoride (CID 175225521) is phenylcarbamothioic S-acid;hydrofluoride.
What is the SMILES notation for phenylcarbamothioic S-acid;hydrofluoride?
The canonical SMILES for phenylcarbamothioic S-acid;hydrofluoride is F.O=C(S)Nc1ccccc1.
What is the InChIKey of phenylcarbamothioic S-acid;hydrofluoride?
The InChIKey is ONIVDNCQMGZWML-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NOS.FH/c9-7(10)8-6-4-2-1-3-5-6;/h1-5H,(H2,8,9,10);1H.
What are the key properties of phenylcarbamothioic S-acid;hydrofluoride?
phenylcarbamothioic S-acid;hydrofluoride has a molecular weight of 173.21 g/mol, XLogP of 2.30, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for phenylcarbamothioic S-acid;hydrofluoride is sourced from PubChem (CID 175225521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).