About gold;N-phenyl-2-sulfanylacetamide
gold;N-phenyl-2-sulfanylacetamide (PubChem CID 138394114) has the molecular formula C8H9AuNOS
and a molecular weight of 364.20 g/mol. Its IUPAC name is gold;N-phenyl-2-sulfanylacetamide.
Molecular Properties
| Compound Name | gold;N-phenyl-2-sulfanylacetamide |
| PubChem CID | 138394114 |
| Molecular Formula | C8H9AuNOS |
| Molecular Weight | 364.20 g/mol |
| Exact Mass | 364.01 |
| IUPAC Name | gold;N-phenyl-2-sulfanylacetamide |
| SMILES | O=C(CS)Nc1ccccc1.[Au] |
| InChI | InChI=1S/C8H9NOS.Au/c10-8(6-11)9-7-4-2-1-3-5-7;/h1-5,11H,6H2,(H,9,10); |
| InChIKey | FCCGLRPQHXBIDH-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.20 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze gold;N-phenyl-2-sulfanylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of gold;N-phenyl-2-sulfanylacetamide?
The IUPAC name of gold;N-phenyl-2-sulfanylacetamide (CID 138394114) is gold;N-phenyl-2-sulfanylacetamide.
What is the SMILES notation for gold;N-phenyl-2-sulfanylacetamide?
The canonical SMILES for gold;N-phenyl-2-sulfanylacetamide is O=C(CS)Nc1ccccc1.[Au].
What is the InChIKey of gold;N-phenyl-2-sulfanylacetamide?
The InChIKey is FCCGLRPQHXBIDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NOS.Au/c10-8(6-11)9-7-4-2-1-3-5-7;/h1-5,11H,6H2,(H,9,10);.
What are the key properties of gold;N-phenyl-2-sulfanylacetamide?
gold;N-phenyl-2-sulfanylacetamide has a molecular weight of 364.20 g/mol, XLogP of 1.55, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for gold;N-phenyl-2-sulfanylacetamide is sourced from PubChem (CID 138394114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).