About carbamothioic S-acid;phenylcarbamothioic S-acid;propanenitrile
carbamothioic S-acid;phenylcarbamothioic S-acid;propanenitrile (PubChem CID 146585965) has the molecular formula C11H15N3O2S2
and a molecular weight of 285.39 g/mol. Its IUPAC name is carbamothioic S-acid;phenylcarbamothioic S-acid;propanenitrile.
Molecular Properties
| Compound Name | carbamothioic S-acid;phenylcarbamothioic S-acid;propanenitrile |
| PubChem CID | 146585965 |
| Molecular Formula | C11H15N3O2S2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | carbamothioic S-acid;phenylcarbamothioic S-acid;propanenitrile |
| SMILES | CCC#N.NC(=O)S.O=C(S)Nc1ccccc1 |
| InChI | InChI=1S/C7H7NOS.C3H5N.CH3NOS/c9-7(10)8-6-4-2-1-3-5-6;1-2-3-4;2-1(3)4/h1-5H,(H2,8,9,10);2H2,1H3;(H3,2,3,4) |
| InChIKey | NFGINOCLNIMLOZ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze carbamothioic S-acid;phenylcarbamothioic S-acid;propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamothioic S-acid;phenylcarbamothioic S-acid;propanenitrile?
The IUPAC name of carbamothioic S-acid;phenylcarbamothioic S-acid;propanenitrile (CID 146585965) is carbamothioic S-acid;phenylcarbamothioic S-acid;propanenitrile.
What is the SMILES notation for carbamothioic S-acid;phenylcarbamothioic S-acid;propanenitrile?
The canonical SMILES for carbamothioic S-acid;phenylcarbamothioic S-acid;propanenitrile is CCC#N.NC(=O)S.O=C(S)Nc1ccccc1.
What is the InChIKey of carbamothioic S-acid;phenylcarbamothioic S-acid;propanenitrile?
The InChIKey is NFGINOCLNIMLOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NOS.C3H5N.CH3NOS/c9-7(10)8-6-4-2-1-3-5-6;1-2-3-4;2-1(3)4/h1-5H,(H2,8,9,10);2H2,1H3;(H3,2,3,4).
What are the key properties of carbamothioic S-acid;phenylcarbamothioic S-acid;propanenitrile?
carbamothioic S-acid;phenylcarbamothioic S-acid;propanenitrile has a molecular weight of 285.39 g/mol, XLogP of 3.06, 1 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbamothioic S-acid;phenylcarbamothioic S-acid;propanenitrile is sourced from PubChem (CID 146585965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).