About ethanol;phenylurea
ethanol;phenylurea (PubChem CID 158950745) has the molecular formula C9H14N2O2
and a molecular weight of 182.22 g/mol. Its IUPAC name is ethanol;phenylurea.
Molecular Properties
| Compound Name | ethanol;phenylurea |
| PubChem CID | 158950745 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | ethanol;phenylurea |
| SMILES | CCO.NC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C7H8N2O.C2H6O/c8-7(10)9-6-4-2-1-3-5-6;1-2-3/h1-5H,(H3,8,9,10);3H,2H2,1H3 |
| InChIKey | JLJWGUMFFYRGHE-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethanol;phenylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanol;phenylurea?
The IUPAC name of ethanol;phenylurea (CID 158950745) is ethanol;phenylurea.
What is the SMILES notation for ethanol;phenylurea?
The canonical SMILES for ethanol;phenylurea is CCO.NC(=O)Nc1ccccc1.
What is the InChIKey of ethanol;phenylurea?
The InChIKey is JLJWGUMFFYRGHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O.C2H6O/c8-7(10)9-6-4-2-1-3-5-6;1-2-3/h1-5H,(H3,8,9,10);3H,2H2,1H3.
What are the key properties of ethanol;phenylurea?
ethanol;phenylurea has a molecular weight of 182.22 g/mol, XLogP of 1.18, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethanol;phenylurea is sourced from PubChem (CID 158950745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).