About sodium;benzylthiourea;hydride
sodium;benzylthiourea;hydride (PubChem CID 173079334) has the molecular formula C8H11N2NaS
and a molecular weight of 190.25 g/mol. Its IUPAC name is sodium;benzylthiourea;hydride.
Molecular Properties
| Compound Name | sodium;benzylthiourea;hydride |
| PubChem CID | 173079334 |
| Molecular Formula | C8H11N2NaS |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.05 |
| IUPAC Name | sodium;benzylthiourea;hydride |
| SMILES | NC(=S)NCc1ccccc1.[H-].[Na+] |
| InChI | InChI=1S/C8H10N2S.Na.H/c9-8(11)10-6-7-4-2-1-3-5-7;;/h1-5H,6H2,(H3,9,10,11);;/q;+1;-1 |
| InChIKey | RJSOSMMQYGTCFS-UHFFFAOYSA-N |
| XLogP | -1.86 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze sodium;benzylthiourea;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;benzylthiourea;hydride?
The IUPAC name of sodium;benzylthiourea;hydride (CID 173079334) is sodium;benzylthiourea;hydride.
What is the SMILES notation for sodium;benzylthiourea;hydride?
The canonical SMILES for sodium;benzylthiourea;hydride is NC(=S)NCc1ccccc1.[H-].[Na+].
What is the InChIKey of sodium;benzylthiourea;hydride?
The InChIKey is RJSOSMMQYGTCFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2S.Na.H/c9-8(11)10-6-7-4-2-1-3-5-7;;/h1-5H,6H2,(H3,9,10,11);;/q;+1;-1.
What are the key properties of sodium;benzylthiourea;hydride?
sodium;benzylthiourea;hydride has a molecular weight of 190.25 g/mol, XLogP of -1.86, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;benzylthiourea;hydride is sourced from PubChem (CID 173079334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).