C10H16Br2N4S2 — CID 87439474
[3-[(carbamothioylamino)methyl]phenyl]methylthiourea;dihydrobromide (PubChem CID 87439474) has the molecular formula C10H16Br2N4S2 and a molecular weight of 416.21 g/mol. Its IUPAC name is [3-[(carbamothioylamino)methyl]phenyl]methylthiourea;dihydrobromide.
| Compound Name | [3-[(carbamothioylamino)methyl]phenyl]methylthiourea;dihydrobromide |
|---|---|
| PubChem CID | 87439474 |
| Molecular Formula | C10H16Br2N4S2 |
| Molecular Weight | 416.21 g/mol |
| Exact Mass | 413.92 |
| IUPAC Name | [3-[(carbamothioylamino)methyl]phenyl]methylthiourea;dihydrobromide |
| SMILES | Br.Br.NC(=S)NCc1cccc(CNC(N)=S)c1 |
| InChI | InChI=1S/C10H14N4S2.2BrH/c11-9(15)13-5-7-2-1-3-8(4-7)6-14-10(12)16;;/h1-4H,5-6H2,(H3,11,13,15)(H3,12,14,16);2*1H |
| InChIKey | XYBLYHGKWDLRCU-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.21 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|