C16H16N4S3 — CID 141212517
[6-[(carbamothioylamino)methyl]dibenzothiophen-4-yl]methylthiourea (PubChem CID 141212517) has the molecular formula C16H16N4S3 and a molecular weight of 360.53 g/mol. Its IUPAC name is [6-[(carbamothioylamino)methyl]dibenzothiophen-4-yl]methylthiourea.
| Compound Name | [6-[(carbamothioylamino)methyl]dibenzothiophen-4-yl]methylthiourea |
|---|---|
| PubChem CID | 141212517 |
| Molecular Formula | C16H16N4S3 |
| Molecular Weight | 360.53 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | [6-[(carbamothioylamino)methyl]dibenzothiophen-4-yl]methylthiourea |
| SMILES | NC(=S)NCc1cccc2c1sc1c(CNC(N)=S)cccc12 |
| InChI | InChI=1S/C16H16N4S3/c17-15(21)19-7-9-3-1-5-11-12-6-2-4-10(8-20-16(18)22)14(12)23-13(9)11/h1-6H,7-8H2,(H3,17,19,21)(H3,18,20,22) |
| InChIKey | LPBQVBSZPNEGHM-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.53 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|