C17H16N4O2S2 — CID 141212497
[5-[(carbamothioylamino)methyl]-9-oxoxanthen-4-yl]methylthiourea (PubChem CID 141212497) has the molecular formula C17H16N4O2S2 and a molecular weight of 372.48 g/mol. Its IUPAC name is [5-[(carbamothioylamino)methyl]-9-oxoxanthen-4-yl]methylthiourea.
| Compound Name | [5-[(carbamothioylamino)methyl]-9-oxoxanthen-4-yl]methylthiourea |
|---|---|
| PubChem CID | 141212497 |
| Molecular Formula | C17H16N4O2S2 |
| Molecular Weight | 372.48 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | [5-[(carbamothioylamino)methyl]-9-oxoxanthen-4-yl]methylthiourea |
| SMILES | NC(=S)NCc1cccc2c(=O)c3cccc(CNC(N)=S)c3oc12 |
| InChI | InChI=1S/C17H16N4O2S2/c18-16(24)20-7-9-3-1-5-11-13(22)12-6-2-4-10(8-21-17(19)25)15(12)23-14(9)11/h1-6H,7-8H2,(H3,18,20,24)(H3,19,21,25) |
| InChIKey | PHLULYYZVXOKHD-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 106.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.48 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|