C16H15BrN4S3 — CID 141212500
[3-bromo-6-[(carbamothioylamino)methyl]dibenzothiophen-4-yl]methylthiourea (PubChem CID 141212500) has the molecular formula C16H15BrN4S3 and a molecular weight of 439.43 g/mol. Its IUPAC name is [3-bromo-6-[(carbamothioylamino)methyl]dibenzothiophen-4-yl]methylthiourea.
| Compound Name | [3-bromo-6-[(carbamothioylamino)methyl]dibenzothiophen-4-yl]methylthiourea |
|---|---|
| PubChem CID | 141212500 |
| Molecular Formula | C16H15BrN4S3 |
| Molecular Weight | 439.43 g/mol |
| Exact Mass | 437.96 |
| IUPAC Name | [3-bromo-6-[(carbamothioylamino)methyl]dibenzothiophen-4-yl]methylthiourea |
| SMILES | NC(=S)NCc1cccc2c1sc1c(CNC(N)=S)c(Br)ccc12 |
| InChI | InChI=1S/C16H15BrN4S3/c17-12-5-4-10-9-3-1-2-8(6-20-15(18)22)13(9)24-14(10)11(12)7-21-16(19)23/h1-5H,6-7H2,(H3,18,20,22)(H3,19,21,23) |
| InChIKey | NBQDZGXEXTXHSI-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.43 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|