About O-carbamothioyl N-benzylcarbamothioate
O-carbamothioyl N-benzylcarbamothioate (PubChem CID 87476638) has the molecular formula C9H10N2OS2
and a molecular weight of 226.33 g/mol. Its IUPAC name is O-carbamothioyl N-benzylcarbamothioate.
Molecular Properties
| Compound Name | O-carbamothioyl N-benzylcarbamothioate |
| PubChem CID | 87476638 |
| Molecular Formula | C9H10N2OS2 |
| Molecular Weight | 226.33 g/mol |
| Exact Mass | 226.02 |
| IUPAC Name | O-carbamothioyl N-benzylcarbamothioate |
| SMILES | NC(=S)OC(=S)NCc1ccccc1 |
| InChI | InChI=1S/C9H10N2OS2/c10-8(13)12-9(14)11-6-7-4-2-1-3-5-7/h1-5H,6H2,(H2,10,13)(H,11,14) |
| InChIKey | MUHRQJMLOLYMSV-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.33 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-carbamothioyl N-benzylcarbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-carbamothioyl N-benzylcarbamothioate?
The IUPAC name of O-carbamothioyl N-benzylcarbamothioate (CID 87476638) is O-carbamothioyl N-benzylcarbamothioate.
What is the SMILES notation for O-carbamothioyl N-benzylcarbamothioate?
The canonical SMILES for O-carbamothioyl N-benzylcarbamothioate is NC(=S)OC(=S)NCc1ccccc1.
What is the InChIKey of O-carbamothioyl N-benzylcarbamothioate?
The InChIKey is MUHRQJMLOLYMSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2OS2/c10-8(13)12-9(14)11-6-7-4-2-1-3-5-7/h1-5H,6H2,(H2,10,13)(H,11,14).
What are the key properties of O-carbamothioyl N-benzylcarbamothioate?
O-carbamothioyl N-benzylcarbamothioate has a molecular weight of 226.33 g/mol, XLogP of 1.32, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for O-carbamothioyl N-benzylcarbamothioate is sourced from PubChem (CID 87476638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).