About O-[2-(dimethylamino)ethyl] N-benzylcarbamothioate
O-[2-(dimethylamino)ethyl] N-benzylcarbamothioate (PubChem CID 13171479) has the molecular formula C12H18N2OS
and a molecular weight of 238.36 g/mol. Its IUPAC name is O-[2-(dimethylamino)ethyl] N-benzylcarbamothioate.
Molecular Properties
| Compound Name | O-[2-(dimethylamino)ethyl] N-benzylcarbamothioate |
| PubChem CID | 13171479 |
| Molecular Formula | C12H18N2OS |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | O-[2-(dimethylamino)ethyl] N-benzylcarbamothioate |
| SMILES | CN(C)CCOC(=S)NCc1ccccc1 |
| InChI | InChI=1S/C12H18N2OS/c1-14(2)8-9-15-12(16)13-10-11-6-4-3-5-7-11/h3-7H,8-10H2,1-2H3,(H,13,16) |
| InChIKey | IRKQFVFGMKVMIX-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-[2-(dimethylamino)ethyl] N-benzylcarbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-[2-(dimethylamino)ethyl] N-benzylcarbamothioate?
The IUPAC name of O-[2-(dimethylamino)ethyl] N-benzylcarbamothioate (CID 13171479) is O-[2-(dimethylamino)ethyl] N-benzylcarbamothioate.
What is the SMILES notation for O-[2-(dimethylamino)ethyl] N-benzylcarbamothioate?
The canonical SMILES for O-[2-(dimethylamino)ethyl] N-benzylcarbamothioate is CN(C)CCOC(=S)NCc1ccccc1.
What is the InChIKey of O-[2-(dimethylamino)ethyl] N-benzylcarbamothioate?
The InChIKey is IRKQFVFGMKVMIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2OS/c1-14(2)8-9-15-12(16)13-10-11-6-4-3-5-7-11/h3-7H,8-10H2,1-2H3,(H,13,16).
What are the key properties of O-[2-(dimethylamino)ethyl] N-benzylcarbamothioate?
O-[2-(dimethylamino)ethyl] N-benzylcarbamothioate has a molecular weight of 238.36 g/mol, XLogP of 1.64, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for O-[2-(dimethylamino)ethyl] N-benzylcarbamothioate is sourced from PubChem (CID 13171479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).