About N-benzylethanethioamide
N-benzylethanethioamide (PubChem CID 3598879) has the molecular formula C9H11NS
and a molecular weight of 165.26 g/mol. Its IUPAC name is N-benzylethanethioamide.
Molecular Properties
| Compound Name | N-benzylethanethioamide |
| PubChem CID | 3598879 |
| Molecular Formula | C9H11NS |
| Molecular Weight | 165.26 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | N-benzylethanethioamide |
| SMILES | CC(=S)NCc1ccccc1 |
| InChI | InChI=1S/C9H11NS/c1-8(11)10-7-9-5-3-2-4-6-9/h2-6H,7H2,1H3,(H,10,11) |
| InChIKey | DAENMPDSCKPTEP-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.26 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-benzylethanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzylethanethioamide?
The IUPAC name of N-benzylethanethioamide (CID 3598879) is N-benzylethanethioamide.
What is the SMILES notation for N-benzylethanethioamide?
The canonical SMILES for N-benzylethanethioamide is CC(=S)NCc1ccccc1.
What is the InChIKey of N-benzylethanethioamide?
The InChIKey is DAENMPDSCKPTEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NS/c1-8(11)10-7-9-5-3-2-4-6-9/h2-6H,7H2,1H3,(H,10,11).
What are the key properties of N-benzylethanethioamide?
N-benzylethanethioamide has a molecular weight of 165.26 g/mol, XLogP of 2.12, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzylethanethioamide is sourced from PubChem (CID 3598879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).