About benzylcarbamothioylsulfanyl N-benzylcarbamodithioate
benzylcarbamothioylsulfanyl N-benzylcarbamodithioate (PubChem CID 57324056) has the molecular formula C16H16N2S4
and a molecular weight of 364.59 g/mol. Its IUPAC name is benzylcarbamothioylsulfanyl N-benzylcarbamodithioate.
Molecular Properties
| Compound Name | benzylcarbamothioylsulfanyl N-benzylcarbamodithioate |
| PubChem CID | 57324056 |
| Molecular Formula | C16H16N2S4 |
| Molecular Weight | 364.59 g/mol |
| Exact Mass | 364.02 |
| IUPAC Name | benzylcarbamothioylsulfanyl N-benzylcarbamodithioate |
| SMILES | S=C(NCc1ccccc1)SSC(=S)NCc1ccccc1 |
| InChI | InChI=1S/C16H16N2S4/c19-15(17-11-13-7-3-1-4-8-13)21-22-16(20)18-12-14-9-5-2-6-10-14/h1-10H,11-12H2,(H,17,19)(H,18,20) |
| InChIKey | VKLBNKCWILJHLW-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.59 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze benzylcarbamothioylsulfanyl N-benzylcarbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzylcarbamothioylsulfanyl N-benzylcarbamodithioate?
The IUPAC name of benzylcarbamothioylsulfanyl N-benzylcarbamodithioate (CID 57324056) is benzylcarbamothioylsulfanyl N-benzylcarbamodithioate.
What is the SMILES notation for benzylcarbamothioylsulfanyl N-benzylcarbamodithioate?
The canonical SMILES for benzylcarbamothioylsulfanyl N-benzylcarbamodithioate is S=C(NCc1ccccc1)SSC(=S)NCc1ccccc1.
What is the InChIKey of benzylcarbamothioylsulfanyl N-benzylcarbamodithioate?
The InChIKey is VKLBNKCWILJHLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2S4/c19-15(17-11-13-7-3-1-4-8-13)21-22-16(20)18-12-14-9-5-2-6-10-14/h1-10H,11-12H2,(H,17,19)(H,18,20).
What are the key properties of benzylcarbamothioylsulfanyl N-benzylcarbamodithioate?
benzylcarbamothioylsulfanyl N-benzylcarbamodithioate has a molecular weight of 364.59 g/mol, XLogP of 4.52, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzylcarbamothioylsulfanyl N-benzylcarbamodithioate is sourced from PubChem (CID 57324056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).