C11H15NO3S3 — CID 132540017
3-(benzylcarbamothioylsulfanyl)propane-1-sulfonic acid (PubChem CID 132540017) has the molecular formula C11H15NO3S3 and a molecular weight of 305.45 g/mol. Its IUPAC name is 3-(benzylcarbamothioylsulfanyl)propane-1-sulfonic acid.
| Compound Name | 3-(benzylcarbamothioylsulfanyl)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 132540017 |
| Molecular Formula | C11H15NO3S3 |
| Molecular Weight | 305.45 g/mol |
| Exact Mass | 305.02 |
| IUPAC Name | 3-(benzylcarbamothioylsulfanyl)propane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CCCSC(=S)NCc1ccccc1 |
| InChI | InChI=1S/C11H15NO3S3/c13-18(14,15)8-4-7-17-11(16)12-9-10-5-2-1-3-6-10/h1-3,5-6H,4,7-9H2,(H,12,16)(H,13,14,15) |
| InChIKey | HWWDONWYWWPVEK-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.45 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_carbam_A(1)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|