C9H12N2O4S — CID 14889772
(benzylcarbamoylamino)methanesulfonic acid (PubChem CID 14889772) has the molecular formula C9H12N2O4S and a molecular weight of 244.27 g/mol. Its IUPAC name is (benzylcarbamoylamino)methanesulfonic acid.
| Compound Name | (benzylcarbamoylamino)methanesulfonic acid |
|---|---|
| PubChem CID | 14889772 |
| Molecular Formula | C9H12N2O4S |
| Molecular Weight | 244.27 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | (benzylcarbamoylamino)methanesulfonic acid |
| SMILES | O=C(NCc1ccccc1)NCS(=O)(=O)O |
| InChI | InChI=1S/C9H12N2O4S/c12-9(11-7-16(13,14)15)10-6-8-4-2-1-3-5-8/h1-5H,6-7H2,(H2,10,11,12)(H,13,14,15) |
| InChIKey | PVZIIGFMJCVOJT-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.27 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|