C27H44Cl2N6O2 — CID 127052927
1-benzyl-3-[3-[5-[3-(benzylcarbamoylamino)propylamino]pentylamino]propyl]urea;dihydrochloride (PubChem CID 127052927) has the molecular formula C27H44Cl2N6O2 and a molecular weight of 555.60 g/mol. Its IUPAC name is 1-benzyl-3-[3-[5-[3-(benzylcarbamoylamino)propylamino]pentylamino]propyl]urea;dihydrochloride.
| Compound Name | 1-benzyl-3-[3-[5-[3-(benzylcarbamoylamino)propylamino]pentylamino]propyl]urea;dihydrochloride |
|---|---|
| PubChem CID | 127052927 |
| Molecular Formula | C27H44Cl2N6O2 |
| Molecular Weight | 555.60 g/mol |
| Exact Mass | 554.29 |
| IUPAC Name | 1-benzyl-3-[3-[5-[3-(benzylcarbamoylamino)propylamino]pentylamino]propyl]urea;dihydrochloride |
| SMILES | Cl.Cl.O=C(NCCCNCCCCCNCCCNC(=O)NCc1ccccc1)NCc1ccccc1 |
| InChI | InChI=1S/C27H42N6O2.2ClH/c34-26(32-22-24-12-4-1-5-13-24)30-20-10-18-28-16-8-3-9-17-29-19-11-21-31-27(35)33-23-25-14-6-2-7-15-25;;/h1-2,4-7,12-15,28-29H,3,8-11,16-23H2,(H2,30,32,34)(H2,31,33,35);2*1H |
| InChIKey | KKFNBBAAEBBLEO-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 106.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.60 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|