C11H17N2O5P — CID 153200062
3-(benzylcarbamoylamino)propyl dihydrogen phosphate (PubChem CID 153200062) has the molecular formula C11H17N2O5P and a molecular weight of 288.24 g/mol. Its IUPAC name is 3-(benzylcarbamoylamino)propyl dihydrogen phosphate.
| Compound Name | 3-(benzylcarbamoylamino)propyl dihydrogen phosphate |
|---|---|
| PubChem CID | 153200062 |
| Molecular Formula | C11H17N2O5P |
| Molecular Weight | 288.24 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 3-(benzylcarbamoylamino)propyl dihydrogen phosphate |
| SMILES | O=C(NCCCOP(=O)(O)O)NCc1ccccc1 |
| InChI | InChI=1S/C11H17N2O5P/c14-11(12-7-4-8-18-19(15,16)17)13-9-10-5-2-1-3-6-10/h1-3,5-6H,4,7-9H2,(H2,12,13,14)(H2,15,16,17) |
| InChIKey | WJSUMGHUFYYSJL-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.24 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|