C24H33N5O3S5 — CID 3036922
3-[bis[2-(benzylcarbamothioylamino)ethyl]carbamothioylsulfanyl]propane-1-sulfonic acid (PubChem CID 3036922) has the molecular formula C24H33N5O3S5 and a molecular weight of 599.90 g/mol. Its IUPAC name is 3-[bis[2-(benzylcarbamothioylamino)ethyl]carbamothioylsulfanyl]propane-1-sulfonic acid.
| Compound Name | 3-[bis[2-(benzylcarbamothioylamino)ethyl]carbamothioylsulfanyl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 3036922 |
| Molecular Formula | C24H33N5O3S5 |
| Molecular Weight | 599.90 g/mol |
| Exact Mass | 599.12 |
| IUPAC Name | 3-[bis[2-(benzylcarbamothioylamino)ethyl]carbamothioylsulfanyl]propane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CCCSC(=S)N(CCNC(=S)NCc1ccccc1)CCNC(=S)NCc1ccccc1 |
| InChI | InChI=1S/C24H33N5O3S5/c30-37(31,32)17-7-16-36-24(35)29(14-12-25-22(33)27-18-20-8-3-1-4-9-20)15-13-26-23(34)28-19-21-10-5-2-6-11-21/h1-6,8-11H,7,12-19H2,(H2,25,27,33)(H2,26,28,34)(H,30,31,32) |
| InChIKey | MEKQYCXNAHUPCW-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 105.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.90 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|