About S-(benzylcarbamothioyl) N-aminocarbamothioate
S-(benzylcarbamothioyl) N-aminocarbamothioate (PubChem CID 54491861) has the molecular formula C9H11N3OS2
and a molecular weight of 241.34 g/mol. Its IUPAC name is S-(benzylcarbamothioyl) N-aminocarbamothioate.
Molecular Properties
| Compound Name | S-(benzylcarbamothioyl) N-aminocarbamothioate |
| PubChem CID | 54491861 |
| Molecular Formula | C9H11N3OS2 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.03 |
| IUPAC Name | S-(benzylcarbamothioyl) N-aminocarbamothioate |
| SMILES | NNC(=O)SC(=S)NCc1ccccc1 |
| InChI | InChI=1S/C9H11N3OS2/c10-12-8(13)15-9(14)11-6-7-4-2-1-3-5-7/h1-5H,6,10H2,(H,11,14)(H,12,13) |
| InChIKey | XWHJMYDIOLFION-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(benzylcarbamothioyl) N-aminocarbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(benzylcarbamothioyl) N-aminocarbamothioate?
The IUPAC name of S-(benzylcarbamothioyl) N-aminocarbamothioate (CID 54491861) is S-(benzylcarbamothioyl) N-aminocarbamothioate.
What is the SMILES notation for S-(benzylcarbamothioyl) N-aminocarbamothioate?
The canonical SMILES for S-(benzylcarbamothioyl) N-aminocarbamothioate is NNC(=O)SC(=S)NCc1ccccc1.
What is the InChIKey of S-(benzylcarbamothioyl) N-aminocarbamothioate?
The InChIKey is XWHJMYDIOLFION-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3OS2/c10-12-8(13)15-9(14)11-6-7-4-2-1-3-5-7/h1-5H,6,10H2,(H,11,14)(H,12,13).
What are the key properties of S-(benzylcarbamothioyl) N-aminocarbamothioate?
S-(benzylcarbamothioyl) N-aminocarbamothioate has a molecular weight of 241.34 g/mol, XLogP of 1.38, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-(benzylcarbamothioyl) N-aminocarbamothioate is sourced from PubChem (CID 54491861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).