About (2-hydroxycyclohexyl) N-benzylcarbamodithioate
(2-hydroxycyclohexyl) N-benzylcarbamodithioate (PubChem CID 71421723) has the molecular formula C14H19NOS2
and a molecular weight of 281.45 g/mol. Its IUPAC name is (2-hydroxycyclohexyl) N-benzylcarbamodithioate.
Molecular Properties
| Compound Name | (2-hydroxycyclohexyl) N-benzylcarbamodithioate |
| PubChem CID | 71421723 |
| Molecular Formula | C14H19NOS2 |
| Molecular Weight | 281.45 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | (2-hydroxycyclohexyl) N-benzylcarbamodithioate |
| SMILES | OC1CCCCC1SC(=S)NCc1ccccc1 |
| InChI | InChI=1S/C14H19NOS2/c16-12-8-4-5-9-13(12)18-14(17)15-10-11-6-2-1-3-7-11/h1-3,6-7,12-13,16H,4-5,8-10H2,(H,15,17) |
| InChIKey | HEAIECGGIBJKEP-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.45 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (2-hydroxycyclohexyl) N-benzylcarbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-hydroxycyclohexyl) N-benzylcarbamodithioate?
The IUPAC name of (2-hydroxycyclohexyl) N-benzylcarbamodithioate (CID 71421723) is (2-hydroxycyclohexyl) N-benzylcarbamodithioate.
What is the SMILES notation for (2-hydroxycyclohexyl) N-benzylcarbamodithioate?
The canonical SMILES for (2-hydroxycyclohexyl) N-benzylcarbamodithioate is OC1CCCCC1SC(=S)NCc1ccccc1.
What is the InChIKey of (2-hydroxycyclohexyl) N-benzylcarbamodithioate?
The InChIKey is HEAIECGGIBJKEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NOS2/c16-12-8-4-5-9-13(12)18-14(17)15-10-11-6-2-1-3-7-11/h1-3,6-7,12-13,16H,4-5,8-10H2,(H,15,17).
What are the key properties of (2-hydroxycyclohexyl) N-benzylcarbamodithioate?
(2-hydroxycyclohexyl) N-benzylcarbamodithioate has a molecular weight of 281.45 g/mol, XLogP of 3.10, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-hydroxycyclohexyl) N-benzylcarbamodithioate is sourced from PubChem (CID 71421723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).