C14H20N2OS — CID 40622519
1-benzyl-3-[(1R,2R)-2-hydroxycyclohexyl]thiourea (PubChem CID 40622519) has the molecular formula C14H20N2OS and a molecular weight of 264.39 g/mol. Its IUPAC name is 1-benzyl-3-[(1R,2R)-2-hydroxycyclohexyl]thiourea.
| Compound Name | 1-benzyl-3-[(1R,2R)-2-hydroxycyclohexyl]thiourea |
|---|---|
| PubChem CID | 40622519 |
| Molecular Formula | C14H20N2OS |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 1-benzyl-3-[(1R,2R)-2-hydroxycyclohexyl]thiourea |
| SMILES | O[C@@H]1CCCC[C@H]1NC(=S)NCc1ccccc1 |
| InChI | InChI=1S/C14H20N2OS/c17-13-9-5-4-8-12(13)16-14(18)15-10-11-6-2-1-3-7-11/h1-3,6-7,12-13,17H,4-5,8-10H2,(H2,15,16,18)/t12-,13-/m1/s1 |
| InChIKey | MQRNCBZBWDBUFJ-CHWSQXEVSA-N |
| XLogP | 1.95 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|