C16H16N2OS2 — CID 138552987
(3-oxo-3-phenylpropyl) N-(pyridin-3-ylmethyl)carbamodithioate (PubChem CID 138552987) has the molecular formula C16H16N2OS2 and a molecular weight of 316.45 g/mol. Its IUPAC name is (3-oxo-3-phenylpropyl) N-(pyridin-3-ylmethyl)carbamodithioate.
| Compound Name | (3-oxo-3-phenylpropyl) N-(pyridin-3-ylmethyl)carbamodithioate |
|---|---|
| PubChem CID | 138552987 |
| Molecular Formula | C16H16N2OS2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | (3-oxo-3-phenylpropyl) N-(pyridin-3-ylmethyl)carbamodithioate |
| SMILES | O=C(CCSC(=S)NCc1cccnc1)c1ccccc1 |
| InChI | InChI=1S/C16H16N2OS2/c19-15(14-6-2-1-3-7-14)8-10-21-16(20)18-12-13-5-4-9-17-11-13/h1-7,9,11H,8,10,12H2,(H,18,20) |
| InChIKey | QYNWTSYRSIFBFX-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_carbam_A(1)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|