C16H19N3OS2 — CID 155019350
(3-oxo-3-pyridin-3-ylpropyl) N-[(2E,4Z)-2-methyl-5-(methylideneamino)penta-2,4-dienyl]carbamodithioate (PubChem CID 155019350) has the molecular formula C16H19N3OS2 and a molecular weight of 333.48 g/mol. Its IUPAC name is (3-oxo-3-pyridin-3-ylpropyl) N-[(2E,4Z)-2-methyl-5-(methylideneamino)penta-2,4-dienyl]carbamodithioate.
| Compound Name | (3-oxo-3-pyridin-3-ylpropyl) N-[(2E,4Z)-2-methyl-5-(methylideneamino)penta-2,4-dienyl]carbamodithioate |
|---|---|
| PubChem CID | 155019350 |
| Molecular Formula | C16H19N3OS2 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | (3-oxo-3-pyridin-3-ylpropyl) N-[(2E,4Z)-2-methyl-5-(methylideneamino)penta-2,4-dienyl]carbamodithioate |
| SMILES | C=N/C=C\C=C(/C)CNC(=S)SCCC(=O)c1cccnc1 |
| InChI | InChI=1S/C16H19N3OS2/c1-13(5-3-8-17-2)11-19-16(21)22-10-7-15(20)14-6-4-9-18-12-14/h3-6,8-9,12H,2,7,10-11H2,1H3,(H,19,21)/b8-3-,13-5+ |
| InChIKey | IKXFRVBUUNXFMZ-QXFCVYADSA-N |
| XLogP | 3.42 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|