C16H14Cl2N2OS2 — CID 138552939
[3-(3,4-dichlorophenyl)-3-oxopropyl] N-(pyridin-3-ylmethyl)carbamodithioate (PubChem CID 138552939) has the molecular formula C16H14Cl2N2OS2 and a molecular weight of 385.34 g/mol. Its IUPAC name is [3-(3,4-dichlorophenyl)-3-oxopropyl] N-(pyridin-3-ylmethyl)carbamodithioate.
| Compound Name | [3-(3,4-dichlorophenyl)-3-oxopropyl] N-(pyridin-3-ylmethyl)carbamodithioate |
|---|---|
| PubChem CID | 138552939 |
| Molecular Formula | C16H14Cl2N2OS2 |
| Molecular Weight | 385.34 g/mol |
| Exact Mass | 383.99 |
| IUPAC Name | [3-(3,4-dichlorophenyl)-3-oxopropyl] N-(pyridin-3-ylmethyl)carbamodithioate |
| SMILES | O=C(CCSC(=S)NCc1cccnc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H14Cl2N2OS2/c17-13-4-3-12(8-14(13)18)15(21)5-7-23-16(22)20-10-11-2-1-6-19-9-11/h1-4,6,8-9H,5,7,10H2,(H,20,22) |
| InChIKey | AKHXTNQVAGNHNE-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.34 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_carbam_A(1)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|