C18H21N3O2S3 — CID 174988888
2-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)ethyl N-(pyridin-3-ylmethyl)carbamodithioate (PubChem CID 174988888) has the molecular formula C18H21N3O2S3 and a molecular weight of 407.59 g/mol. Its IUPAC name is 2-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)ethyl N-(pyridin-3-ylmethyl)carbamodithioate.
| Compound Name | 2-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)ethyl N-(pyridin-3-ylmethyl)carbamodithioate |
|---|---|
| PubChem CID | 174988888 |
| Molecular Formula | C18H21N3O2S3 |
| Molecular Weight | 407.59 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | 2-(3,4-dihydro-1H-isoquinolin-2-ylsulfonyl)ethyl N-(pyridin-3-ylmethyl)carbamodithioate |
| SMILES | O=S(=O)(CCSC(=S)NCc1cccnc1)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C18H21N3O2S3/c22-26(23,21-9-7-16-5-1-2-6-17(16)14-21)11-10-25-18(24)20-13-15-4-3-8-19-12-15/h1-6,8,12H,7,9-11,13-14H2,(H,20,24) |
| InChIKey | VOYNMPZZNDTMGG-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.59 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_carbam_A(1)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|