C15H16N2O2S — CID 166282081
2-benzylsulfonyl-3,4-dihydro-1H-2,7-naphthyridine (PubChem CID 166282081) has the molecular formula C15H16N2O2S and a molecular weight of 288.37 g/mol. Its IUPAC name is 2-benzylsulfonyl-3,4-dihydro-1H-2,7-naphthyridine.
| Compound Name | 2-benzylsulfonyl-3,4-dihydro-1H-2,7-naphthyridine |
|---|---|
| PubChem CID | 166282081 |
| Molecular Formula | C15H16N2O2S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 2-benzylsulfonyl-3,4-dihydro-1H-2,7-naphthyridine |
| SMILES | O=S(=O)(Cc1ccccc1)N1CCc2ccncc2C1 |
| InChI | InChI=1S/C15H16N2O2S/c18-20(19,12-13-4-2-1-3-5-13)17-9-7-14-6-8-16-10-15(14)11-17/h1-6,8,10H,7,9,11-12H2 |
| InChIKey | ITNVPRWHKUWZBM-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |