C16H25N3O3S4 — CID 165342556
3-[(E)-N'-(diethylcarbamothioylsulfanylmethyl)-N-phenylcarbamimidoyl]sulfanylpropane-1-sulfonic acid (PubChem CID 165342556) has the molecular formula C16H25N3O3S4 and a molecular weight of 435.66 g/mol. Its IUPAC name is 3-[(E)-N'-(diethylcarbamothioylsulfanylmethyl)-N-phenylcarbamimidoyl]sulfanylpropane-1-sulfonic acid.
| Compound Name | 3-[(E)-N'-(diethylcarbamothioylsulfanylmethyl)-N-phenylcarbamimidoyl]sulfanylpropane-1-sulfonic acid |
|---|---|
| PubChem CID | 165342556 |
| Molecular Formula | C16H25N3O3S4 |
| Molecular Weight | 435.66 g/mol |
| Exact Mass | 435.08 |
| IUPAC Name | 3-[(E)-N'-(diethylcarbamothioylsulfanylmethyl)-N-phenylcarbamimidoyl]sulfanylpropane-1-sulfonic acid |
| SMILES | CCN(CC)C(=S)SC/N=C(\Nc1ccccc1)SCCCS(=O)(=O)O |
| InChI | InChI=1S/C16H25N3O3S4/c1-3-19(4-2)16(23)25-13-17-15(18-14-9-6-5-7-10-14)24-11-8-12-26(20,21)22/h5-7,9-10H,3-4,8,11-13H2,1-2H3,(H,17,18)(H,20,21,22) |
| InChIKey | GAAGGFCEJQAFSM-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.66 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|