About 2-(N'-butyl-N-phenylcarbamimidoyl)sulfanylacetic acid;tridecane
2-(N'-butyl-N-phenylcarbamimidoyl)sulfanylacetic acid;tridecane (PubChem CID 143224779) has the molecular formula C26H46N2O2S
and a molecular weight of 450.73 g/mol. Its IUPAC name is 2-(N'-butyl-N-phenylcarbamimidoyl)sulfanylacetic acid;tridecane.
Molecular Properties
| Compound Name | 2-(N'-butyl-N-phenylcarbamimidoyl)sulfanylacetic acid;tridecane |
| PubChem CID | 143224779 |
| Molecular Formula | C26H46N2O2S |
| Molecular Weight | 450.73 g/mol |
| Exact Mass | 450.33 |
| IUPAC Name | 2-(N'-butyl-N-phenylcarbamimidoyl)sulfanylacetic acid;tridecane |
| SMILES | CCCC/N=C(/Nc1ccccc1)SCC(=O)O.CCCCCCCCCCCCC |
| InChI | InChI=1S/C13H18N2O2S.C13H28/c1-2-3-9-14-13(18-10-12(16)17)15-11-7-5-4-6-8-11;1-3-5-7-9-11-13-12-10-8-6-4-2/h4-8H,2-3,9-10H2,1H3,(H,14,15)(H,16,17);3-13H2,1-2H3 |
| InChIKey | NPLQQOPANAAAKF-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 450.73 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(N'-butyl-N-phenylcarbamimidoyl)sulfanylacetic acid;tridecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(N'-butyl-N-phenylcarbamimidoyl)sulfanylacetic acid;tridecane?
The IUPAC name of 2-(N'-butyl-N-phenylcarbamimidoyl)sulfanylacetic acid;tridecane (CID 143224779) is 2-(N'-butyl-N-phenylcarbamimidoyl)sulfanylacetic acid;tridecane.
What is the SMILES notation for 2-(N'-butyl-N-phenylcarbamimidoyl)sulfanylacetic acid;tridecane?
The canonical SMILES for 2-(N'-butyl-N-phenylcarbamimidoyl)sulfanylacetic acid;tridecane is CCCC/N=C(/Nc1ccccc1)SCC(=O)O.CCCCCCCCCCCCC.
What is the InChIKey of 2-(N'-butyl-N-phenylcarbamimidoyl)sulfanylacetic acid;tridecane?
The InChIKey is NPLQQOPANAAAKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2O2S.C13H28/c1-2-3-9-14-13(18-10-12(16)17)15-11-7-5-4-6-8-11;1-3-5-7-9-11-13-12-10-8-6-4-2/h4-8H,2-3,9-10H2,1H3,(H,14,15)(H,16,17);3-13H2,1-2H3.
What are the key properties of 2-(N'-butyl-N-phenylcarbamimidoyl)sulfanylacetic acid;tridecane?
2-(N'-butyl-N-phenylcarbamimidoyl)sulfanylacetic acid;tridecane has a molecular weight of 450.73 g/mol, XLogP of 8.39, 16 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(N'-butyl-N-phenylcarbamimidoyl)sulfanylacetic acid;tridecane is sourced from PubChem (CID 143224779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).