C18H20BrN3O — CID 139243346
N-[N-(4-bromophenyl)-N'-butylcarbamimidoyl]benzamide (PubChem CID 139243346) has the molecular formula C18H20BrN3O and a molecular weight of 374.28 g/mol. Its IUPAC name is N-[N-(4-bromophenyl)-N'-butylcarbamimidoyl]benzamide.
| Compound Name | N-[N-(4-bromophenyl)-N'-butylcarbamimidoyl]benzamide |
|---|---|
| PubChem CID | 139243346 |
| Molecular Formula | C18H20BrN3O |
| Molecular Weight | 374.28 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | N-[N-(4-bromophenyl)-N'-butylcarbamimidoyl]benzamide |
| SMILES | CCCC/N=C(\NC(=O)c1ccccc1)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C18H20BrN3O/c1-2-3-13-20-18(21-16-11-9-15(19)10-12-16)22-17(23)14-7-5-4-6-8-14/h4-12H,2-3,13H2,1H3,(H2,20,21,22,23) |
| InChIKey | DXHPSIQBQDOPQF-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.28 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|