C20H22BrFN4O2 — CID 50820095
N-[N-(4-bromophenyl)-N'-(2-morpholin-4-ylethyl)carbamimidoyl]-4-fluorobenzamide (PubChem CID 50820095) has the molecular formula C20H22BrFN4O2 and a molecular weight of 449.32 g/mol. Its IUPAC name is N-[N-(4-bromophenyl)-N'-(2-morpholin-4-ylethyl)carbamimidoyl]-4-fluorobenzamide.
| Compound Name | N-[N-(4-bromophenyl)-N'-(2-morpholin-4-ylethyl)carbamimidoyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 50820095 |
| Molecular Formula | C20H22BrFN4O2 |
| Molecular Weight | 449.32 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | N-[N-(4-bromophenyl)-N'-(2-morpholin-4-ylethyl)carbamimidoyl]-4-fluorobenzamide |
| SMILES | O=C(N/C(=N\CCN1CCOCC1)Nc1ccc(Br)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H22BrFN4O2/c21-16-3-7-18(8-4-16)24-20(23-9-10-26-11-13-28-14-12-26)25-19(27)15-1-5-17(22)6-2-15/h1-8H,9-14H2,(H2,23,24,25,27) |
| InChIKey | AMOBOZIDUYOPJF-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.32 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|