C22H25F3N4O3 — CID 50819416
N-[N-(4-methoxyphenyl)-N'-(2-morpholin-4-ylethyl)carbamimidoyl]-4-(trifluoromethyl)benzamide (PubChem CID 50819416) has the molecular formula C22H25F3N4O3 and a molecular weight of 450.46 g/mol. Its IUPAC name is N-[N-(4-methoxyphenyl)-N'-(2-morpholin-4-ylethyl)carbamimidoyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[N-(4-methoxyphenyl)-N'-(2-morpholin-4-ylethyl)carbamimidoyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 50819416 |
| Molecular Formula | C22H25F3N4O3 |
| Molecular Weight | 450.46 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | N-[N-(4-methoxyphenyl)-N'-(2-morpholin-4-ylethyl)carbamimidoyl]-4-(trifluoromethyl)benzamide |
| SMILES | COc1ccc(N/C(=N/CCN2CCOCC2)NC(=O)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C22H25F3N4O3/c1-31-19-8-6-18(7-9-19)27-21(26-10-11-29-12-14-32-15-13-29)28-20(30)16-2-4-17(5-3-16)22(23,24)25/h2-9H,10-15H2,1H3,(H2,26,27,28,30) |
| InChIKey | MIYOAPWCPDQNAF-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.46 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|