C24H32N4O4 — CID 50820098
N-[N-(3,4-dimethylphenyl)-N'-(2-morpholin-4-ylethyl)carbamimidoyl]-3,5-dimethoxybenzamide (PubChem CID 50820098) has the molecular formula C24H32N4O4 and a molecular weight of 440.54 g/mol. Its IUPAC name is N-[N-(3,4-dimethylphenyl)-N'-(2-morpholin-4-ylethyl)carbamimidoyl]-3,5-dimethoxybenzamide.
| Compound Name | N-[N-(3,4-dimethylphenyl)-N'-(2-morpholin-4-ylethyl)carbamimidoyl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 50820098 |
| Molecular Formula | C24H32N4O4 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | N-[N-(3,4-dimethylphenyl)-N'-(2-morpholin-4-ylethyl)carbamimidoyl]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)N/C(=N\CCN2CCOCC2)Nc2ccc(C)c(C)c2)c1 |
| InChI | InChI=1S/C24H32N4O4/c1-17-5-6-20(13-18(17)2)26-24(25-7-8-28-9-11-32-12-10-28)27-23(29)19-14-21(30-3)16-22(15-19)31-4/h5-6,13-16H,7-12H2,1-4H3,(H2,25,26,27,29) |
| InChIKey | IHFKMZSYOAHXJW-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|