C13H19N3O2 — CID 139222881
ethyl N-(N-phenyl-N'-propylcarbamimidoyl)carbamate (PubChem CID 139222881) has the molecular formula C13H19N3O2 and a molecular weight of 249.31 g/mol. Its IUPAC name is ethyl N-(N-phenyl-N'-propylcarbamimidoyl)carbamate.
| Compound Name | ethyl N-(N-phenyl-N'-propylcarbamimidoyl)carbamate |
|---|---|
| PubChem CID | 139222881 |
| Molecular Formula | C13H19N3O2 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | ethyl N-(N-phenyl-N'-propylcarbamimidoyl)carbamate |
| SMILES | CCC/N=C(\NC(=O)OCC)Nc1ccccc1 |
| InChI | InChI=1S/C13H19N3O2/c1-3-10-14-12(16-13(17)18-4-2)15-11-8-6-5-7-9-11/h5-9H,3-4,10H2,1-2H3,(H2,14,15,16,17) |
| InChIKey | CAQBRCPUINXWTA-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|