C28H32N6O6 — CID 56933620
ethyl N-[N-[4-[3-[4-[(N-ethoxycarbonyl-N'-methylcarbamimidoyl)amino]phenoxy]phenoxy]phenyl]-N'-methylcarbamimidoyl]carbamate (PubChem CID 56933620) has the molecular formula C28H32N6O6 and a molecular weight of 548.60 g/mol. Its IUPAC name is ethyl N-[N-[4-[3-[4-[(N-ethoxycarbonyl-N'-methylcarbamimidoyl)amino]phenoxy]phenoxy]phenyl]-N'-methylcarbamimidoyl]carbamate.
| Compound Name | ethyl N-[N-[4-[3-[4-[(N-ethoxycarbonyl-N'-methylcarbamimidoyl)amino]phenoxy]phenoxy]phenyl]-N'-methylcarbamimidoyl]carbamate |
|---|---|
| PubChem CID | 56933620 |
| Molecular Formula | C28H32N6O6 |
| Molecular Weight | 548.60 g/mol |
| Exact Mass | 548.24 |
| IUPAC Name | ethyl N-[N-[4-[3-[4-[(N-ethoxycarbonyl-N'-methylcarbamimidoyl)amino]phenoxy]phenoxy]phenyl]-N'-methylcarbamimidoyl]carbamate |
| SMILES | CCOC(=O)N/C(=N\C)Nc1ccc(Oc2cccc(Oc3ccc(N/C(=N/C)NC(=O)OCC)cc3)c2)cc1 |
| InChI | InChI=1S/C28H32N6O6/c1-5-37-27(35)33-25(29-3)31-19-10-14-21(15-11-19)39-23-8-7-9-24(18-23)40-22-16-12-20(13-17-22)32-26(30-4)34-28(36)38-6-2/h7-18H,5-6H2,1-4H3,(H2,29,31,33,35)(H2,30,32,34,36) |
| InChIKey | QNIRKWKDNWKBIT-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 143.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.60 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|