C21H19BrN4O — CID 50817965
N-[N-(4-bromophenyl)-N'-(pyridin-2-ylmethyl)carbamimidoyl]-3-methylbenzamide (PubChem CID 50817965) has the molecular formula C21H19BrN4O and a molecular weight of 423.31 g/mol. Its IUPAC name is N-[N-(4-bromophenyl)-N'-(pyridin-2-ylmethyl)carbamimidoyl]-3-methylbenzamide.
| Compound Name | N-[N-(4-bromophenyl)-N'-(pyridin-2-ylmethyl)carbamimidoyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 50817965 |
| Molecular Formula | C21H19BrN4O |
| Molecular Weight | 423.31 g/mol |
| Exact Mass | 422.07 |
| IUPAC Name | N-[N-(4-bromophenyl)-N'-(pyridin-2-ylmethyl)carbamimidoyl]-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)N/C(=N\Cc2ccccn2)Nc2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C21H19BrN4O/c1-15-5-4-6-16(13-15)20(27)26-21(24-14-19-7-2-3-12-23-19)25-18-10-8-17(22)9-11-18/h2-13H,14H2,1H3,(H2,24,25,26,27) |
| InChIKey | ZPQPCFBUEHHHAC-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.31 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|