C22H19ClN4O3 — CID 50818566
methyl 4-[[N-(3-chlorophenyl)-N'-(pyridin-2-ylmethyl)carbamimidoyl]carbamoyl]benzoate (PubChem CID 50818566) has the molecular formula C22H19ClN4O3 and a molecular weight of 422.87 g/mol. Its IUPAC name is methyl 4-[[N-(3-chlorophenyl)-N'-(pyridin-2-ylmethyl)carbamimidoyl]carbamoyl]benzoate.
| Compound Name | methyl 4-[[N-(3-chlorophenyl)-N'-(pyridin-2-ylmethyl)carbamimidoyl]carbamoyl]benzoate |
|---|---|
| PubChem CID | 50818566 |
| Molecular Formula | C22H19ClN4O3 |
| Molecular Weight | 422.87 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | methyl 4-[[N-(3-chlorophenyl)-N'-(pyridin-2-ylmethyl)carbamimidoyl]carbamoyl]benzoate |
| SMILES | COC(=O)c1ccc(C(=O)N/C(=N\Cc2ccccn2)Nc2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C22H19ClN4O3/c1-30-21(29)16-10-8-15(9-11-16)20(28)27-22(25-14-19-6-2-3-12-24-19)26-18-7-4-5-17(23)13-18/h2-13H,14H2,1H3,(H2,25,26,27,28) |
| InChIKey | RANMOLZRGWOCDQ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.87 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|