C23H23ClN4O2 — CID 50818061
N-[N-(3-chloro-2-methylphenyl)-N'-(pyridin-2-ylmethyl)carbamimidoyl]-4-ethoxybenzamide (PubChem CID 50818061) has the molecular formula C23H23ClN4O2 and a molecular weight of 422.92 g/mol. Its IUPAC name is N-[N-(3-chloro-2-methylphenyl)-N'-(pyridin-2-ylmethyl)carbamimidoyl]-4-ethoxybenzamide.
| Compound Name | N-[N-(3-chloro-2-methylphenyl)-N'-(pyridin-2-ylmethyl)carbamimidoyl]-4-ethoxybenzamide |
|---|---|
| PubChem CID | 50818061 |
| Molecular Formula | C23H23ClN4O2 |
| Molecular Weight | 422.92 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | N-[N-(3-chloro-2-methylphenyl)-N'-(pyridin-2-ylmethyl)carbamimidoyl]-4-ethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)N/C(=N\Cc2ccccn2)Nc2cccc(Cl)c2C)cc1 |
| InChI | InChI=1S/C23H23ClN4O2/c1-3-30-19-12-10-17(11-13-19)22(29)28-23(26-15-18-7-4-5-14-25-18)27-21-9-6-8-20(24)16(21)2/h4-14H,3,15H2,1-2H3,(H2,26,27,28,29) |
| InChIKey | NFRXIDVZZVDIOL-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.92 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|