C15H13Cl2N3O2 — CID 7230477
methyl N-(3,4-dichlorobenzoyl)-N'-(pyridin-2-ylmethyl)carbamimidate (PubChem CID 7230477) has the molecular formula C15H13Cl2N3O2 and a molecular weight of 338.19 g/mol. Its IUPAC name is methyl N-(3,4-dichlorobenzoyl)-N'-(pyridin-2-ylmethyl)carbamimidate.
| Compound Name | methyl N-(3,4-dichlorobenzoyl)-N'-(pyridin-2-ylmethyl)carbamimidate |
|---|---|
| PubChem CID | 7230477 |
| Molecular Formula | C15H13Cl2N3O2 |
| Molecular Weight | 338.19 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | methyl N-(3,4-dichlorobenzoyl)-N'-(pyridin-2-ylmethyl)carbamimidate |
| SMILES | CO/C(=N\Cc1ccccn1)NC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H13Cl2N3O2/c1-22-15(19-9-11-4-2-3-7-18-11)20-14(21)10-5-6-12(16)13(17)8-10/h2-8H,9H2,1H3,(H,19,20,21) |
| InChIKey | UYZOPTCCXBDYTP-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.19 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|