C23H21F3N4O3 — CID 50818366
3,5-dimethoxy-N-[N'-(pyridin-2-ylmethyl)-N-[3-(trifluoromethyl)phenyl]carbamimidoyl]benzamide (PubChem CID 50818366) has the molecular formula C23H21F3N4O3 and a molecular weight of 458.44 g/mol. Its IUPAC name is 3,5-dimethoxy-N-[N'-(pyridin-2-ylmethyl)-N-[3-(trifluoromethyl)phenyl]carbamimidoyl]benzamide.
| Compound Name | 3,5-dimethoxy-N-[N'-(pyridin-2-ylmethyl)-N-[3-(trifluoromethyl)phenyl]carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 50818366 |
| Molecular Formula | C23H21F3N4O3 |
| Molecular Weight | 458.44 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | 3,5-dimethoxy-N-[N'-(pyridin-2-ylmethyl)-N-[3-(trifluoromethyl)phenyl]carbamimidoyl]benzamide |
| SMILES | COc1cc(OC)cc(C(=O)N/C(=N\Cc2ccccn2)Nc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C23H21F3N4O3/c1-32-19-10-15(11-20(13-19)33-2)21(31)30-22(28-14-18-7-3-4-9-27-18)29-17-8-5-6-16(12-17)23(24,25)26/h3-13H,14H2,1-2H3,(H2,28,29,30,31) |
| InChIKey | LXLVTWCFNIJZTF-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.44 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|