C16H13F3N2O3 — CID 69054016
5-methoxy-3-N-[3-(trifluoromethyl)phenyl]benzene-1,3-dicarboxamide (PubChem CID 69054016) has the molecular formula C16H13F3N2O3 and a molecular weight of 338.29 g/mol. Its IUPAC name is 5-methoxy-3-N-[3-(trifluoromethyl)phenyl]benzene-1,3-dicarboxamide.
| Compound Name | 5-methoxy-3-N-[3-(trifluoromethyl)phenyl]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 69054016 |
| Molecular Formula | C16H13F3N2O3 |
| Molecular Weight | 338.29 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 5-methoxy-3-N-[3-(trifluoromethyl)phenyl]benzene-1,3-dicarboxamide |
| SMILES | COc1cc(C(N)=O)cc(C(=O)Nc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C16H13F3N2O3/c1-24-13-6-9(14(20)22)5-10(7-13)15(23)21-12-4-2-3-11(8-12)16(17,18)19/h2-8H,1H3,(H2,20,22)(H,21,23) |
| InChIKey | TWKHKXRXGIYZLA-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.29 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |