C25H43N3OS — CID 13083480
propyl N,N'-diheptyl-N-(phenylcarbamoyl)carbamimidothioate (PubChem CID 13083480) has the molecular formula C25H43N3OS and a molecular weight of 433.71 g/mol. Its IUPAC name is propyl N,N'-diheptyl-N-(phenylcarbamoyl)carbamimidothioate.
| Compound Name | propyl N,N'-diheptyl-N-(phenylcarbamoyl)carbamimidothioate |
|---|---|
| PubChem CID | 13083480 |
| Molecular Formula | C25H43N3OS |
| Molecular Weight | 433.71 g/mol |
| Exact Mass | 433.31 |
| IUPAC Name | propyl N,N'-diheptyl-N-(phenylcarbamoyl)carbamimidothioate |
| SMILES | CCCCCCC/N=C(\SCCC)N(CCCCCCC)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C25H43N3OS/c1-4-7-9-11-16-20-26-25(30-22-6-3)28(21-17-12-10-8-5-2)24(29)27-23-18-14-13-15-19-23/h13-15,18-19H,4-12,16-17,20-22H2,1-3H3,(H,27,29)/b26-25- |
| InChIKey | WTVQPKGLKTXCIS-QPLCGJKRSA-N |
| XLogP | 7.96 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.71 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|