C20H22N6S2 — CID 1371224
(4,6-dianilino-1,3,5-triazin-2-yl) N,N-diethylcarbamodithioate (PubChem CID 1371224) has the molecular formula C20H22N6S2 and a molecular weight of 410.57 g/mol. Its IUPAC name is (4,6-dianilino-1,3,5-triazin-2-yl) N,N-diethylcarbamodithioate.
| Compound Name | (4,6-dianilino-1,3,5-triazin-2-yl) N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 1371224 |
| Molecular Formula | C20H22N6S2 |
| Molecular Weight | 410.57 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | (4,6-dianilino-1,3,5-triazin-2-yl) N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)Sc1nc(Nc2ccccc2)nc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C20H22N6S2/c1-3-26(4-2)20(27)28-19-24-17(21-15-11-7-5-8-12-15)23-18(25-19)22-16-13-9-6-10-14-16/h5-14H,3-4H2,1-2H3,(H2,21,22,23,24,25) |
| InChIKey | WOOHJKMIMPKYPF-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.57 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|