C16H20N6S2 — CID 1318896
(4-amino-6-anilino-1,3,5-triazin-2-yl)methyl piperidine-1-carbodithioate (PubChem CID 1318896) has the molecular formula C16H20N6S2 and a molecular weight of 360.51 g/mol. Its IUPAC name is (4-amino-6-anilino-1,3,5-triazin-2-yl)methyl piperidine-1-carbodithioate.
| Compound Name | (4-amino-6-anilino-1,3,5-triazin-2-yl)methyl piperidine-1-carbodithioate |
|---|---|
| PubChem CID | 1318896 |
| Molecular Formula | C16H20N6S2 |
| Molecular Weight | 360.51 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | (4-amino-6-anilino-1,3,5-triazin-2-yl)methyl piperidine-1-carbodithioate |
| SMILES | Nc1nc(CSC(=S)N2CCCCC2)nc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C16H20N6S2/c17-14-19-13(11-24-16(23)22-9-5-2-6-10-22)20-15(21-14)18-12-7-3-1-4-8-12/h1,3-4,7-8H,2,5-6,9-11H2,(H3,17,18,19,20,21) |
| InChIKey | RNOFGJQAYGXWSW-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.51 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|