C16H22N6 — CID 900594
6-(azepan-1-ylmethyl)-2-N-phenyl-1,3,5-triazine-2,4-diamine (PubChem CID 900594) has the molecular formula C16H22N6 and a molecular weight of 298.39 g/mol. Its IUPAC name is 6-(azepan-1-ylmethyl)-2-N-phenyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(azepan-1-ylmethyl)-2-N-phenyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 900594 |
| Molecular Formula | C16H22N6 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | 6-(azepan-1-ylmethyl)-2-N-phenyl-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(CN2CCCCCC2)nc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C16H22N6/c17-15-19-14(12-22-10-6-1-2-7-11-22)20-16(21-15)18-13-8-4-3-5-9-13/h3-5,8-9H,1-2,6-7,10-12H2,(H3,17,18,19,20,21) |
| InChIKey | FPWCSKYRBFILLH-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |