C14H16ClN5 — CID 836972
4-chloro-N-phenyl-6-piperidin-1-yl-1,3,5-triazin-2-amine (PubChem CID 836972) has the molecular formula C14H16ClN5 and a molecular weight of 289.77 g/mol. Its IUPAC name is 4-chloro-N-phenyl-6-piperidin-1-yl-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-N-phenyl-6-piperidin-1-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 836972 |
| Molecular Formula | C14H16ClN5 |
| Molecular Weight | 289.77 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 4-chloro-N-phenyl-6-piperidin-1-yl-1,3,5-triazin-2-amine |
| SMILES | Clc1nc(Nc2ccccc2)nc(N2CCCCC2)n1 |
| InChI | InChI=1S/C14H16ClN5/c15-12-17-13(16-11-7-3-1-4-8-11)19-14(18-12)20-9-5-2-6-10-20/h1,3-4,7-8H,2,5-6,9-10H2,(H,16,17,18,19) |
| InChIKey | WBCIXTQLRTTWMJ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.77 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |