C7H15NO3S3 — CID 3014360
2-(diethylcarbamothioylsulfanyl)ethanesulfonic acid (PubChem CID 3014360) has the molecular formula C7H15NO3S3 and a molecular weight of 257.40 g/mol. Its IUPAC name is 2-(diethylcarbamothioylsulfanyl)ethanesulfonic acid.
| Compound Name | 2-(diethylcarbamothioylsulfanyl)ethanesulfonic acid |
|---|---|
| PubChem CID | 3014360 |
| Molecular Formula | C7H15NO3S3 |
| Molecular Weight | 257.40 g/mol |
| Exact Mass | 257.02 |
| IUPAC Name | 2-(diethylcarbamothioylsulfanyl)ethanesulfonic acid |
| SMILES | CCN(CC)C(=S)SCCS(=O)(=O)O |
| InChI | InChI=1S/C7H15NO3S3/c1-3-8(4-2)7(12)13-5-6-14(9,10)11/h3-6H2,1-2H3,(H,9,10,11) |
| InChIKey | XGEYWPMONHFRSV-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.40 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|