C11H21NOS2 — CID 174674399
2-(3-methyloxetan-3-yl)ethyl N,N-diethylcarbamodithioate (PubChem CID 174674399) has the molecular formula C11H21NOS2 and a molecular weight of 247.43 g/mol. Its IUPAC name is 2-(3-methyloxetan-3-yl)ethyl N,N-diethylcarbamodithioate.
| Compound Name | 2-(3-methyloxetan-3-yl)ethyl N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 174674399 |
| Molecular Formula | C11H21NOS2 |
| Molecular Weight | 247.43 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 2-(3-methyloxetan-3-yl)ethyl N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)SCCC1(C)COC1 |
| InChI | InChI=1S/C11H21NOS2/c1-4-12(5-2)10(14)15-7-6-11(3)8-13-9-11/h4-9H2,1-3H3 |
| InChIKey | DDCYPZBDILHLRJ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.43 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|