C18H31NO5S2 — CID 102398494
[(3aS,4R,6aS)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl N,N-diethylcarbamodithioate (PubChem CID 102398494) has the molecular formula C18H31NO5S2 and a molecular weight of 405.58 g/mol. Its IUPAC name is [(3aS,4R,6aS)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl N,N-diethylcarbamodithioate.
| Compound Name | [(3aS,4R,6aS)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 102398494 |
| Molecular Formula | C18H31NO5S2 |
| Molecular Weight | 405.58 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | [(3aS,4R,6aS)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)SCC1O[C@H]([C@H]2COC(C)(C)O2)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C18H31NO5S2/c1-7-19(8-2)16(25)26-10-12-14-15(24-18(5,6)23-14)13(21-12)11-9-20-17(3,4)22-11/h11-15H,7-10H2,1-6H3/t11-,12?,13-,14-,15+/m1/s1 |
| InChIKey | DWEKTZJMMODBNL-ZWBVZUSMSA-N |
| XLogP | 2.79 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.58 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|