C13H23NO7S3 — CID 71745822
[(3aR,5S,6R,6aR)-2,2-dimethyl-6-sulfooxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl N,N-diethylcarbamodithioate (PubChem CID 71745822) has the molecular formula C13H23NO7S3 and a molecular weight of 401.53 g/mol. Its IUPAC name is [(3aR,5S,6R,6aR)-2,2-dimethyl-6-sulfooxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl N,N-diethylcarbamodithioate.
| Compound Name | [(3aR,5S,6R,6aR)-2,2-dimethyl-6-sulfooxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 71745822 |
| Molecular Formula | C13H23NO7S3 |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | [(3aR,5S,6R,6aR)-2,2-dimethyl-6-sulfooxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)SC[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1OS(=O)(=O)O |
| InChI | InChI=1S/C13H23NO7S3/c1-5-14(6-2)12(22)23-7-8-9(21-24(15,16)17)10-11(18-8)20-13(3,4)19-10/h8-11H,5-7H2,1-4H3,(H,15,16,17)/t8-,9+,10-,11-/m1/s1 |
| InChIKey | NVRUFXNHKYRNCF-LMLFDSFASA-N |
| XLogP | 1.41 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|