C13H21NO7S3 — CID 71746360
[(3aR,5S,6R,6aR)-2,2-dimethyl-6-sulfooxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl pyrrolidine-1-carbodithioate (PubChem CID 71746360) has the molecular formula C13H21NO7S3 and a molecular weight of 399.51 g/mol. Its IUPAC name is [(3aR,5S,6R,6aR)-2,2-dimethyl-6-sulfooxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl pyrrolidine-1-carbodithioate.
| Compound Name | [(3aR,5S,6R,6aR)-2,2-dimethyl-6-sulfooxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl pyrrolidine-1-carbodithioate |
|---|---|
| PubChem CID | 71746360 |
| Molecular Formula | C13H21NO7S3 |
| Molecular Weight | 399.51 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | [(3aR,5S,6R,6aR)-2,2-dimethyl-6-sulfooxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl pyrrolidine-1-carbodithioate |
| SMILES | CC1(C)O[C@H]2O[C@H](CSC(=S)N3CCCC3)[C@H](OS(=O)(=O)O)[C@H]2O1 |
| InChI | InChI=1S/C13H21NO7S3/c1-13(2)19-10-9(21-24(15,16)17)8(18-11(10)20-13)7-23-12(22)14-5-3-4-6-14/h8-11H,3-7H2,1-2H3,(H,15,16,17)/t8-,9+,10-,11-/m1/s1 |
| InChIKey | ZVCJBSXEWURXDB-LMLFDSFASA-N |
| XLogP | 1.16 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.51 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|